C26H24F3N3O3 — CID 122655018
N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]-N-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydro-1H-indole-4-carboxamide (PubChem CID 122655018) has the molecular formula C26H24F3N3O3 and a molecular weight of 483.49 g/mol. Its IUPAC name is N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]-N-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydro-1H-indole-4-carboxamide.
| Compound Name | N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]-N-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydro-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 122655018 |
| Molecular Formula | C26H24F3N3O3 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]-N-[4-[(3,4,5-trifluorophenyl)methyl]-2-pyridinyl]-2,3-dihydro-1H-indole-4-carboxamide |
| SMILES | O=C(c1cccc2c1CCN2)N(CC1(CO)COC1)c1cc(Cc2cc(F)c(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C26H24F3N3O3/c27-20-9-17(10-21(28)24(20)29)8-16-4-6-31-23(11-16)32(12-26(13-33)14-35-15-26)25(34)19-2-1-3-22-18(19)5-7-30-22/h1-4,6,9-11,30,33H,5,7-8,12-15H2 |
| InChIKey | ZXMUZSDBSULTFA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|