About 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile
4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile (PubChem CID 122655667) has the molecular formula C21H13ClN2O
and a molecular weight of 344.80 g/mol. Its IUPAC name is 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile |
| PubChem CID | 122655667 |
| Molecular Formula | C21H13ClN2O |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(Cl)c2-c2ccc3c(c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C21H13ClN2O/c22-18-3-1-2-17(14-6-4-13(12-23)5-7-14)21(18)15-8-9-19-16(10-15)11-20(25)24-19/h1-10H,11H2,(H,24,25) |
| InChIKey | DCDQAELUXCPELU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile?
The IUPAC name of 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile (CID 122655667) is 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile.
What is the SMILES notation for 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile?
The canonical SMILES for 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile is N#Cc1ccc(-c2cccc(Cl)c2-c2ccc3c(c2)CC(=O)N3)cc1.
What is the InChIKey of 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile?
The InChIKey is DCDQAELUXCPELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13ClN2O/c22-18-3-1-2-17(14-6-4-13(12-23)5-7-14)21(18)15-8-9-19-16(10-15)11-20(25)24-19/h1-10H,11H2,(H,24,25).
What are the key properties of 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile?
4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile has a molecular weight of 344.80 g/mol, XLogP of 5.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-chloro-2-(2-oxo-1,3-dihydroindol-5-yl)phenyl]benzonitrile is sourced from PubChem (CID 122655667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).