About 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one
5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one (PubChem CID 122656069) has the molecular formula C25H21N5O3
and a molecular weight of 439.48 g/mol. Its IUPAC name is 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one |
| PubChem CID | 122656069 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(-c3c(C(=O)c4ccccc4)nc4c(N5CCOCC5)nccn34)ccc2N1 |
| InChI | InChI=1S/C25H21N5O3/c31-20-15-18-14-17(6-7-19(18)27-20)22-21(23(32)16-4-2-1-3-5-16)28-25-24(26-8-9-30(22)25)29-10-12-33-13-11-29/h1-9,14H,10-13,15H2,(H,27,31) |
| InChIKey | ZKKOBIRDZDDYCP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one?
The IUPAC name of 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one (CID 122656069) is 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one?
The canonical SMILES for 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one is O=C1Cc2cc(-c3c(C(=O)c4ccccc4)nc4c(N5CCOCC5)nccn34)ccc2N1.
What is the InChIKey of 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one?
The InChIKey is ZKKOBIRDZDDYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N5O3/c31-20-15-18-14-17(6-7-19(18)27-20)22-21(23(32)16-4-2-1-3-5-16)28-25-24(26-8-9-30(22)25)29-10-12-33-13-11-29/h1-9,14H,10-13,15H2,(H,27,31).
What are the key properties of 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one?
5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one has a molecular weight of 439.48 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-benzoyl-8-morpholin-4-ylimidazo[1,2-a]pyrazin-3-yl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 122656069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).