About 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile
4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile (PubChem CID 122656475) has the molecular formula C15H7ClF3N3O2
and a molecular weight of 353.69 g/mol. Its IUPAC name is 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile.
Molecular Properties
| Compound Name | 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile |
| PubChem CID | 122656475 |
| Molecular Formula | C15H7ClF3N3O2 |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile |
| SMILES | N#Cc1ccc(Cl)c(-c2ccc3[nH]c(=O)[nH]c3c2)c1OC(F)(F)F |
| InChI | InChI=1S/C15H7ClF3N3O2/c16-9-3-1-8(6-20)13(24-15(17,18)19)12(9)7-2-4-10-11(5-7)22-14(23)21-10/h1-5H,(H2,21,22,23) |
| InChIKey | YGLLJFHBVCSNBU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile?
The IUPAC name of 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile (CID 122656475) is 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile.
What is the SMILES notation for 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile?
The canonical SMILES for 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile is N#Cc1ccc(Cl)c(-c2ccc3[nH]c(=O)[nH]c3c2)c1OC(F)(F)F.
What is the InChIKey of 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile?
The InChIKey is YGLLJFHBVCSNBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7ClF3N3O2/c16-9-3-1-8(6-20)13(24-15(17,18)19)12(9)7-2-4-10-11(5-7)22-14(23)21-10/h1-5H,(H2,21,22,23).
What are the key properties of 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile?
4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile has a molecular weight of 353.69 g/mol, XLogP of 3.95, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-2-(trifluoromethoxy)benzonitrile is sourced from PubChem (CID 122656475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).