About 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile
2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile (PubChem CID 122656686) has the molecular formula C17H14ClN3O
and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile |
| PubChem CID | 122656686 |
| Molecular Formula | C17H14ClN3O |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1cccc(Cl)c1-c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H14ClN3O/c1-17(2,9-19)11-4-3-5-12(18)15(11)10-6-7-13-14(8-10)21-16(22)20-13/h3-8H,1-2H3,(H2,20,21,22) |
| InChIKey | REXAIHPUMHWTOH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile?
The IUPAC name of 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile (CID 122656686) is 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile.
What is the SMILES notation for 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile?
The canonical SMILES for 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile is CC(C)(C#N)c1cccc(Cl)c1-c1ccc2[nH]c(=O)[nH]c2c1.
What is the InChIKey of 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile?
The InChIKey is REXAIHPUMHWTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O/c1-17(2,9-19)11-4-3-5-12(18)15(11)10-6-7-13-14(8-10)21-16(22)20-13/h3-8H,1-2H3,(H2,20,21,22).
What are the key properties of 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile?
2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile has a molecular weight of 311.77 g/mol, XLogP of 3.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-chloro-2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]-2-methylpropanenitrile is sourced from PubChem (CID 122656686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).