C14H19F2N3O3 — CID 122656893
3,3-difluoro-N'-(3,4,5-trimethoxyphenyl)pyrrolidine-1-carboximidamide (PubChem CID 122656893) has the molecular formula C14H19F2N3O3 and a molecular weight of 315.32 g/mol. Its IUPAC name is 3,3-difluoro-N'-(3,4,5-trimethoxyphenyl)pyrrolidine-1-carboximidamide.
| Compound Name | 3,3-difluoro-N'-(3,4,5-trimethoxyphenyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 122656893 |
| Molecular Formula | C14H19F2N3O3 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3,3-difluoro-N'-(3,4,5-trimethoxyphenyl)pyrrolidine-1-carboximidamide |
| SMILES | COc1cc(/N=C(\N)N2CCC(F)(F)C2)cc(OC)c1OC |
| InChI | InChI=1S/C14H19F2N3O3/c1-20-10-6-9(7-11(21-2)12(10)22-3)18-13(17)19-5-4-14(15,16)8-19/h6-7H,4-5,8H2,1-3H3,(H2,17,18) |
| InChIKey | AWEZGEVUKSVFNA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|