About N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide
N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide (PubChem CID 122656959) has the molecular formula C6H11F2N5
and a molecular weight of 191.19 g/mol. Its IUPAC name is N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide |
| PubChem CID | 122656959 |
| Molecular Formula | C6H11F2N5 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C6H11F2N5/c7-6(8)1-2-13(3-6)5(11)12-4(9)10/h1-3H2,(H5,9,10,11,12) |
| InChIKey | WSAJHBNOMLVDLD-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide?
The IUPAC name of N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide (CID 122656959) is N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide.
What is the SMILES notation for N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide?
The canonical SMILES for N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide is [H]/N=C(\N=C(N)N)N1CCC(F)(F)C1.
What is the InChIKey of N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide?
The InChIKey is WSAJHBNOMLVDLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2N5/c7-6(8)1-2-13(3-6)5(11)12-4(9)10/h1-3H2,(H5,9,10,11,12).
What are the key properties of N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide?
N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide has a molecular weight of 191.19 g/mol, XLogP of -0.46, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-3,3-difluoropyrrolidine-1-carboximidamide is sourced from PubChem (CID 122656959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).