C23H17ClF7NO2 — CID 122657075
methyl 2-chloro-5-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1H-pyrrol-3-yl]benzoate (PubChem CID 122657075) has the molecular formula C23H17ClF7NO2 and a molecular weight of 507.83 g/mol. Its IUPAC name is methyl 2-chloro-5-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1H-pyrrol-3-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1H-pyrrol-3-yl]benzoate |
|---|---|
| PubChem CID | 122657075 |
| Molecular Formula | C23H17ClF7NO2 |
| Molecular Weight | 507.83 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | methyl 2-chloro-5-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-1H-pyrrol-3-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2cc[nH]c2-c2c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C)ccc1Cl |
| InChI | InChI=1S/C23H17ClF7NO2/c1-11-8-14(21(25,22(26,27)28)23(29,30)31)9-12(2)18(11)19-15(6-7-32-19)13-4-5-17(24)16(10-13)20(33)34-3/h4-10,32H,1-3H3 |
| InChIKey | PWDSUVLZBKQTGL-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.83 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |