C12H23NO3 — CID 122657802
(3R,4S,5R,6R)-6-hex-5-enyl-5-(hydroxymethyl)piperidine-3,4-diol (PubChem CID 122657802) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-hex-5-enyl-5-(hydroxymethyl)piperidine-3,4-diol.
| Compound Name | (3R,4S,5R,6R)-6-hex-5-enyl-5-(hydroxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 122657802 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | (3R,4S,5R,6R)-6-hex-5-enyl-5-(hydroxymethyl)piperidine-3,4-diol |
| SMILES | C=CCCCC[C@H]1NC[C@@H](O)[C@@H](O)[C@H]1CO |
| InChI | InChI=1S/C12H23NO3/c1-2-3-4-5-6-10-9(8-14)12(16)11(15)7-13-10/h2,9-16H,1,3-8H2/t9-,10+,11+,12-/m0/s1 |
| InChIKey | BGVAOVCHHRDRPD-QCNOEVLYSA-N |
| XLogP | 0.03 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|