C15H31NO3 — CID 122657820
(3R,4S,5R,6R)-5-(hydroxymethyl)-6-nonylpiperidine-3,4-diol (PubChem CID 122657820) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is (3R,4S,5R,6R)-5-(hydroxymethyl)-6-nonylpiperidine-3,4-diol.
| Compound Name | (3R,4S,5R,6R)-5-(hydroxymethyl)-6-nonylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 122657820 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | (3R,4S,5R,6R)-5-(hydroxymethyl)-6-nonylpiperidine-3,4-diol |
| SMILES | CCCCCCCCC[C@H]1NC[C@@H](O)[C@@H](O)[C@H]1CO |
| InChI | InChI=1S/C15H31NO3/c1-2-3-4-5-6-7-8-9-13-12(11-17)15(19)14(18)10-16-13/h12-19H,2-11H2,1H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | FAUJNJKIHJSYDO-YJNKXOJESA-N |
| XLogP | 1.43 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|