C16H24N2O2 — CID 122657878
(1R,3S,5S)-1-tert-butyl-3-(cyanomethyl)-3-ethenyl-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 122657878) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1R,3S,5S)-1-tert-butyl-3-(cyanomethyl)-3-ethenyl-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1R,3S,5S)-1-tert-butyl-3-(cyanomethyl)-3-ethenyl-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 122657878 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (1R,3S,5S)-1-tert-butyl-3-(cyanomethyl)-3-ethenyl-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | C=C[C@@]1(CC#N)C[C@@H]2CC[C@](C(C)(C)C)(C1)N2C(=O)O |
| InChI | InChI=1S/C16H24N2O2/c1-5-15(8-9-17)10-12-6-7-16(11-15,14(2,3)4)18(12)13(19)20/h5,12H,1,6-8,10-11H2,2-4H3,(H,19,20)/t12-,15+,16+/m0/s1 |
| InChIKey | FRSATNSDTINFDV-APHBMKBZSA-N |
| XLogP | 3.79 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|