About (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol
(2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol (PubChem CID 122657948) has the molecular formula C10H14F2N2O
and a molecular weight of 216.23 g/mol. Its IUPAC name is (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol |
| PubChem CID | 122657948 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol |
| SMILES | Cn1nccc1[C@@H]1C(O)CCCC1(F)F |
| InChI | InChI=1S/C10H14F2N2O/c1-14-7(4-6-13-14)9-8(15)3-2-5-10(9,11)12/h4,6,8-9,15H,2-3,5H2,1H3/t8?,9-/m1/s1 |
| InChIKey | WZFQGPDIHMLYJP-YGPZHTELSA-N |
| XLogP | 1.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol?
The IUPAC name of (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol (CID 122657948) is (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol.
What is the SMILES notation for (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol?
The canonical SMILES for (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol is Cn1nccc1[C@@H]1C(O)CCCC1(F)F.
What is the InChIKey of (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol?
The InChIKey is WZFQGPDIHMLYJP-YGPZHTELSA-N. The full InChI is InChI=1S/C10H14F2N2O/c1-14-7(4-6-13-14)9-8(15)3-2-5-10(9,11)12/h4,6,8-9,15H,2-3,5H2,1H3/t8?,9-/m1/s1.
What are the key properties of (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol?
(2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol has a molecular weight of 216.23 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,3-difluoro-2-(2-methylpyrazol-3-yl)cyclohexan-1-ol is sourced from PubChem (CID 122657948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).