C15H19N3O2S — CID 122658574
[(8aS)-8a-(3-aminophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]carbamic acid (PubChem CID 122658574) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is [(8aS)-8a-(3-aminophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]carbamic acid.
| Compound Name | [(8aS)-8a-(3-aminophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 122658574 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [(8aS)-8a-(3-aminophenyl)-4,4a,5,6,7,8-hexahydro-3,1-benzothiazin-2-yl]carbamic acid |
| SMILES | Nc1cccc([C@]23CCCCC2CSC(NC(=O)O)=N3)c1 |
| InChI | InChI=1S/C15H19N3O2S/c16-12-6-3-5-10(8-12)15-7-2-1-4-11(15)9-21-13(18-15)17-14(19)20/h3,5-6,8,11H,1-2,4,7,9,16H2,(H,17,18)(H,19,20)/t11?,15-/m1/s1 |
| InChIKey | KJQAVMCWAGGNGU-JOPIAHFSSA-N |
| XLogP | 3.02 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|