C14H15FN5O3S+ — CID 122658608
[5-[(8aS)-2-(carboxyamino)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-2-fluorophenyl]imino-iminoazanium (PubChem CID 122658608) has the molecular formula C14H15FN5O3S+ and a molecular weight of 352.37 g/mol. Its IUPAC name is [5-[(8aS)-2-(carboxyamino)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-2-fluorophenyl]imino-iminoazanium.
| Compound Name | [5-[(8aS)-2-(carboxyamino)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-2-fluorophenyl]imino-iminoazanium |
|---|---|
| PubChem CID | 122658608 |
| Molecular Formula | C14H15FN5O3S+ |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [5-[(8aS)-2-(carboxyamino)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-8a-yl]-2-fluorophenyl]imino-iminoazanium |
| SMILES | N=[N+]=Nc1cc([C@]23CCOCC2CSC(NC(=O)O)=N3)ccc1F |
| InChI | InChI=1S/C14H14FN5O3S/c15-10-2-1-8(5-11(10)19-20-16)14-3-4-23-6-9(14)7-24-12(18-14)17-13(21)22/h1-2,5,9,16H,3-4,6-7H2,(H-,17,18,21,22)/p+1/t9?,14-/m1/s1 |
| InChIKey | RDNCSTURIHMEBP-IWSPRGBSSA-O |
| XLogP | 2.61 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|