C14H19N7O3 — CID 122658861
5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-1,3-oxazol-2-amine (PubChem CID 122658861) has the molecular formula C14H19N7O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-1,3-oxazol-2-amine.
| Compound Name | 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 122658861 |
| Molecular Formula | C14H19N7O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-1,3-oxazol-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)nc(N3CCOCC3)n2)o1 |
| InChI | InChI=1S/C14H19N7O3/c15-12-16-9-10(24-12)11-17-13(20-1-5-22-6-2-20)19-14(18-11)21-3-7-23-8-4-21/h9H,1-8H2,(H2,15,16) |
| InChIKey | BBQHBLPSSJFFCI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |