C10H22N2 — CID 122659054
(E)-2,2,5,5-tetramethylhexan-3-ylidenehydrazine (PubChem CID 122659054) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (E)-2,2,5,5-tetramethylhexan-3-ylidenehydrazine.
| Compound Name | (E)-2,2,5,5-tetramethylhexan-3-ylidenehydrazine |
|---|---|
| PubChem CID | 122659054 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (E)-2,2,5,5-tetramethylhexan-3-ylidenehydrazine |
| SMILES | CC(C)(C)C/C(=N\N)C(C)(C)C |
| InChI | InChI=1S/C10H22N2/c1-9(2,3)7-8(12-11)10(4,5)6/h7,11H2,1-6H3/b12-8+ |
| InChIKey | RDQAHXJPYGWSOR-XYOKQWHBSA-N |
| XLogP | 2.78 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|