C13H20N4 — CID 122659357
[3-ethyl-6-(1H-1,2,4-triazol-5-ylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]methanamine (PubChem CID 122659357) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is [3-ethyl-6-(1H-1,2,4-triazol-5-ylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]methanamine.
| Compound Name | [3-ethyl-6-(1H-1,2,4-triazol-5-ylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]methanamine |
|---|---|
| PubChem CID | 122659357 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | [3-ethyl-6-(1H-1,2,4-triazol-5-ylmethyl)-6-bicyclo[3.2.0]hept-3-enyl]methanamine |
| SMILES | CCC1=CC2C(C1)CC2(CN)Cc1ncn[nH]1 |
| InChI | InChI=1S/C13H20N4/c1-2-9-3-10-5-13(7-14,11(10)4-9)6-12-15-8-16-17-12/h4,8,10-11H,2-3,5-7,14H2,1H3,(H,15,16,17) |
| InChIKey | HXTAPXIRKUVPRE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|