C50H26F10N4S — CID 122659570
N-(2,3,4,5,6-pentafluorophenyl)-N-[4-[5-[4-(2,3,4,5,6-pentafluoro-N-(6-phenyl-3-pyridinyl)anilino)phenyl]thiophen-2-yl]phenyl]-6-phenylpyridin-3-amine (PubChem CID 122659570) has the molecular formula C50H26F10N4S and a molecular weight of 904.83 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-N-[4-[5-[4-(2,3,4,5,6-pentafluoro-N-(6-phenyl-3-pyridinyl)anilino)phenyl]thiophen-2-yl]phenyl]-6-phenylpyridin-3-amine.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-N-[4-[5-[4-(2,3,4,5,6-pentafluoro-N-(6-phenyl-3-pyridinyl)anilino)phenyl]thiophen-2-yl]phenyl]-6-phenylpyridin-3-amine |
|---|---|
| PubChem CID | 122659570 |
| Molecular Formula | C50H26F10N4S |
| Molecular Weight | 904.83 g/mol |
| Exact Mass | 904.17 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-N-[4-[5-[4-(2,3,4,5,6-pentafluoro-N-(6-phenyl-3-pyridinyl)anilino)phenyl]thiophen-2-yl]phenyl]-6-phenylpyridin-3-amine |
| SMILES | Fc1c(F)c(F)c(N(c2ccc(-c3ccc(-c4ccc(N(c5ccc(-c6ccccc6)nc5)c5c(F)c(F)c(F)c(F)c5F)cc4)s3)cc2)c2ccc(-c3ccccc3)nc2)c(F)c1F |
| InChI | InChI=1S/C50H26F10N4S/c51-39-41(53)45(57)49(46(58)42(39)54)63(33-19-21-35(61-25-33)27-7-3-1-4-8-27)31-15-11-29(12-16-31)37-23-24-38(65-37)30-13-17-32(18-14-30)64(50-47(59)43(55)40(52)44(56)48(50)60)34-20-22-36(62-26-34)28-9-5-2-6-10-28/h1-26H |
| InChIKey | FHJDHHFRIJSYDD-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.83 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|