About dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate
dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate (PubChem CID 122660918) has the molecular formula C10H13NO5
and a molecular weight of 227.22 g/mol. Its IUPAC name is dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate |
| PubChem CID | 122660918 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate |
| SMILES | COC(=O)/C(C)=C(/C=C\C=N\O)C(=O)OC |
| InChI | InChI=1S/C10H13NO5/c1-7(9(12)15-2)8(10(13)16-3)5-4-6-11-14/h4-6,14H,1-3H3/b5-4-,8-7-,11-6+ |
| InChIKey | DAYUKIBESMRLGI-NWSIQZGGSA-N |
| XLogP | 0.67 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate?
The IUPAC name of dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate (CID 122660918) is dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate.
What is the SMILES notation for dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate?
The canonical SMILES for dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate is COC(=O)/C(C)=C(/C=C\C=N\O)C(=O)OC.
What is the InChIKey of dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate?
The InChIKey is DAYUKIBESMRLGI-NWSIQZGGSA-N. The full InChI is InChI=1S/C10H13NO5/c1-7(9(12)15-2)8(10(13)16-3)5-4-6-11-14/h4-6,14H,1-3H3/b5-4-,8-7-,11-6+.
What are the key properties of dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate?
dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate has a molecular weight of 227.22 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (Z)-2-[(Z,3E)-3-hydroxyiminoprop-1-enyl]-3-methylbut-2-enedioate is sourced from PubChem (CID 122660918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).