About (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate
(4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate (PubChem CID 122661017) has the molecular formula C26H41NO7
and a molecular weight of 479.61 g/mol. Its IUPAC name is (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate.
Molecular Properties
| Compound Name | (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate |
| PubChem CID | 122661017 |
| Molecular Formula | C26H41NO7 |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate |
| SMILES | CCCC(CCCCCCCCCCOC1CCCCO1)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H41NO7/c1-2-13-23(33-26(28)34-24-18-16-22(17-19-24)27(29)30)14-9-7-5-3-4-6-8-11-20-31-25-15-10-12-21-32-25/h16-19,23,25H,2-15,20-21H2,1H3 |
| InChIKey | CLRNPLBQICRBFG-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate?
The IUPAC name of (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate (CID 122661017) is (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate.
What is the SMILES notation for (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate?
The canonical SMILES for (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate is CCCC(CCCCCCCCCCOC1CCCCO1)OC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate?
The InChIKey is CLRNPLBQICRBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H41NO7/c1-2-13-23(33-26(28)34-24-18-16-22(17-19-24)27(29)30)14-9-7-5-3-4-6-8-11-20-31-25-15-10-12-21-32-25/h16-19,23,25H,2-15,20-21H2,1H3.
What are the key properties of (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate?
(4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate has a molecular weight of 479.61 g/mol, XLogP of 7.33, 17 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) 14-(oxan-2-yloxy)tetradecan-4-yl carbonate is sourced from PubChem (CID 122661017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).