C18H17F4N5 — CID 122661651
(2E)-4-[1H-indazol-5-yl-[C-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)carbonimidoyl]amino]-3-methylpenta-2,4-dienimidoyl fluoride (PubChem CID 122661651) has the molecular formula C18H17F4N5 and a molecular weight of 379.36 g/mol. Its IUPAC name is (2E)-4-[1H-indazol-5-yl-[C-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)carbonimidoyl]amino]-3-methylpenta-2,4-dienimidoyl fluoride.
| Compound Name | (2E)-4-[1H-indazol-5-yl-[C-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)carbonimidoyl]amino]-3-methylpenta-2,4-dienimidoyl fluoride |
|---|---|
| PubChem CID | 122661651 |
| Molecular Formula | C18H17F4N5 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (2E)-4-[1H-indazol-5-yl-[C-methyl-N-(3,3,3-trifluoroprop-1-en-2-yl)carbonimidoyl]amino]-3-methylpenta-2,4-dienimidoyl fluoride |
| SMILES | [H]/N=C(F)/C=C(\C)C(=C)N(/C(C)=N/C(=C)C(F)(F)F)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C18H17F4N5/c1-10(7-17(19)23)11(2)27(13(4)25-12(3)18(20,21)22)15-5-6-16-14(8-15)9-24-26-16/h5-9,23H,2-3H2,1,4H3,(H,24,26)/b10-7+,23-17-,25-13+ |
| InChIKey | GWLXCRIDCJFIFW-ZISKZEFJSA-N |
| XLogP | 5.27 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|