C18H20N4O6 — CID 122661848
(2S)-2,6-bis[(2-oxo-1H-pyridine-3-carbonyl)amino]hexanoic acid (PubChem CID 122661848) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is (2S)-2,6-bis[(2-oxo-1H-pyridine-3-carbonyl)amino]hexanoic acid.
| Compound Name | (2S)-2,6-bis[(2-oxo-1H-pyridine-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122661848 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2S)-2,6-bis[(2-oxo-1H-pyridine-3-carbonyl)amino]hexanoic acid |
| SMILES | O=C(NCCCC[C@H](NC(=O)c1ccc[nH]c1=O)C(=O)O)c1ccc[nH]c1=O |
| InChI | InChI=1S/C18H20N4O6/c23-14(11-5-3-9-20-15(11)24)19-8-2-1-7-13(18(27)28)22-17(26)12-6-4-10-21-16(12)25/h3-6,9-10,13H,1-2,7-8H2,(H,19,23)(H,20,24)(H,21,25)(H,22,26)(H,27,28)/t13-/m0/s1 |
| InChIKey | WRJPLXGCOXSOEY-ZDUSSCGKSA-N |
| XLogP | -0.15 |
| TPSA | 161.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|