C25H25N3O12 — CID 122661973
[3-[4-[(2-amino-2-oxoethyl)-(3-hydroxy-2-methoxycarbonyloxybenzoyl)amino]butyl]-2,4-dioxo-1,3-benzoxazin-8-yl] methyl carbonate (PubChem CID 122661973) has the molecular formula C25H25N3O12 and a molecular weight of 559.48 g/mol. Its IUPAC name is [3-[4-[(2-amino-2-oxoethyl)-(3-hydroxy-2-methoxycarbonyloxybenzoyl)amino]butyl]-2,4-dioxo-1,3-benzoxazin-8-yl] methyl carbonate.
| Compound Name | [3-[4-[(2-amino-2-oxoethyl)-(3-hydroxy-2-methoxycarbonyloxybenzoyl)amino]butyl]-2,4-dioxo-1,3-benzoxazin-8-yl] methyl carbonate |
|---|---|
| PubChem CID | 122661973 |
| Molecular Formula | C25H25N3O12 |
| Molecular Weight | 559.48 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | [3-[4-[(2-amino-2-oxoethyl)-(3-hydroxy-2-methoxycarbonyloxybenzoyl)amino]butyl]-2,4-dioxo-1,3-benzoxazin-8-yl] methyl carbonate |
| SMILES | COC(=O)Oc1c(O)cccc1C(=O)N(CCCCn1c(=O)oc2c(OC(=O)OC)cccc2c1=O)CC(N)=O |
| InChI | InChI=1S/C25H25N3O12/c1-36-24(34)38-17-10-6-8-15-20(17)39-23(33)28(22(15)32)12-4-3-11-27(13-18(26)30)21(31)14-7-5-9-16(29)19(14)40-25(35)37-2/h5-10,29H,3-4,11-13H2,1-2H3,(H2,26,30) |
| InChIKey | PTKUIIGMDWGZFM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 206.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|