C27H32N2O6 — CID 122662559
methyl (E)-2-[(2S,3S,7aS,12bS)-3-ethyl-9-(furan-3-yl)-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate (PubChem CID 122662559) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is methyl (E)-2-[(2S,3S,7aS,12bS)-3-ethyl-9-(furan-3-yl)-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(2S,3S,7aS,12bS)-3-ethyl-9-(furan-3-yl)-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 122662559 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | methyl (E)-2-[(2S,3S,7aS,12bS)-3-ethyl-9-(furan-3-yl)-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@@H]1CN2CC[C@@]3(O)C(=Nc4ccc(-c5ccoc5)c(OC)c43)[C@@H]2C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C27H32N2O6/c1-5-16-13-29-10-9-27(31)23-21(7-6-18(24(23)33-3)17-8-11-35-14-17)28-25(27)22(29)12-19(16)20(15-32-2)26(30)34-4/h6-8,11,14-16,19,22,31H,5,9-10,12-13H2,1-4H3/b20-15+/t16-,19+,22+,27+/m1/s1 |
| InChIKey | AAWUTGDJUMVVMF-PWAHGHQFSA-N |
| XLogP | 4.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|