C21H25NO4 — CID 122662623
(2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(2-nitrophenyl)-2H-furan-5-one (PubChem CID 122662623) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(2-nitrophenyl)-2H-furan-5-one.
| Compound Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(2-nitrophenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 122662623 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(2-nitrophenyl)-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=C[C@H](c2ccccc2[N+](=O)[O-])OC1=O |
| InChI | InChI=1S/C21H25NO4/c1-15(2)8-6-9-16(3)10-7-11-17-14-20(26-21(17)23)18-12-4-5-13-19(18)22(24)25/h4-5,8,10,12-14,20H,6-7,9,11H2,1-3H3/b16-10+/t20-/m1/s1 |
| InChIKey | SELHHTJXIAXVRF-NXZBIGBUSA-N |
| XLogP | 5.59 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|