C24H32O2 — CID 122662633
(2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-propan-2-ylphenyl)-2H-furan-5-one (PubChem CID 122662633) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-propan-2-ylphenyl)-2H-furan-5-one.
| Compound Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-propan-2-ylphenyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 122662633 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-propan-2-ylphenyl)-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=C[C@H](c2ccc(C(C)C)cc2)OC1=O |
| InChI | InChI=1S/C24H32O2/c1-17(2)8-6-9-19(5)10-7-11-22-16-23(26-24(22)25)21-14-12-20(13-15-21)18(3)4/h8,10,12-16,18,23H,6-7,9,11H2,1-5H3/b19-10+/t23-/m1/s1 |
| InChIKey | BJVIHVBQYYYUPN-ALMVOQMYSA-N |
| XLogP | 6.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|