C25H34O2 — CID 122662634
(2R)-2-(4-tert-butylphenyl)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one (PubChem CID 122662634) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is (2R)-2-(4-tert-butylphenyl)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one.
| Compound Name | (2R)-2-(4-tert-butylphenyl)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 122662634 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (2R)-2-(4-tert-butylphenyl)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=C[C@H](c2ccc(C(C)(C)C)cc2)OC1=O |
| InChI | InChI=1S/C25H34O2/c1-18(2)9-7-10-19(3)11-8-12-21-17-23(27-24(21)26)20-13-15-22(16-14-20)25(4,5)6/h9,11,13-17,23H,7-8,10,12H2,1-6H3/b19-11+/t23-/m1/s1 |
| InChIKey | LKUMSNIZHCXTOE-QNJILJPISA-N |
| XLogP | 6.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|