About (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one
(2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one (PubChem CID 122662637) has the molecular formula C21H25NO4
and a molecular weight of 355.43 g/mol. Its IUPAC name is (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one |
| PubChem CID | 122662637 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=C[C@H](c2ccc([N+](=O)[O-])cc2)OC1=O |
| InChI | InChI=1S/C21H25NO4/c1-15(2)6-4-7-16(3)8-5-9-18-14-20(26-21(18)23)17-10-12-19(13-11-17)22(24)25/h6,8,10-14,20H,4-5,7,9H2,1-3H3/b16-8+/t20-/m1/s1 |
| InChIKey | BKVDEJBFSRGNGS-MOWFPQLSSA-N |
| XLogP | 5.59 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one?
The IUPAC name of (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one (CID 122662637) is (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one.
What is the SMILES notation for (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one?
The canonical SMILES for (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one is CC(C)=CCC/C(C)=C/CCC1=C[C@H](c2ccc([N+](=O)[O-])cc2)OC1=O.
What is the InChIKey of (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one?
The InChIKey is BKVDEJBFSRGNGS-MOWFPQLSSA-N. The full InChI is InChI=1S/C21H25NO4/c1-15(2)6-4-7-16(3)8-5-9-18-14-20(26-21(18)23)17-10-12-19(13-11-17)22(24)25/h6,8,10-14,20H,4-5,7,9H2,1-3H3/b16-8+/t20-/m1/s1.
What are the key properties of (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one?
(2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one has a molecular weight of 355.43 g/mol, XLogP of 5.59, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-(4-nitrophenyl)-2H-furan-5-one is sourced from PubChem (CID 122662637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).