C9H17NO — CID 122662743
8a-ethyl-1,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,4-a]pyridine (PubChem CID 122662743) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 8a-ethyl-1,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,4-a]pyridine.
| Compound Name | 8a-ethyl-1,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,4-a]pyridine |
|---|---|
| PubChem CID | 122662743 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 8a-ethyl-1,3,5,6,7,8-hexahydro-[1,3]oxazolo[3,4-a]pyridine |
| SMILES | CCC12CCCCN1COC2 |
| InChI | InChI=1S/C9H17NO/c1-2-9-5-3-4-6-10(9)8-11-7-9/h2-8H2,1H3 |
| InChIKey | HIHTWGPSYMKJOZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |