About 5-hydrazinylcyclohexa-1,3-dien-1-ol
5-hydrazinylcyclohexa-1,3-dien-1-ol (PubChem CID 122662756) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 5-hydrazinylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 5-hydrazinylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 122662756 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 5-hydrazinylcyclohexa-1,3-dien-1-ol |
| SMILES | NNC1C=CC=C(O)C1 |
| InChI | InChI=1S/C6H10N2O/c7-8-5-2-1-3-6(9)4-5/h1-3,5,8-9H,4,7H2 |
| InChIKey | URIZNYYQEKUWMP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydrazinylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydrazinylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 5-hydrazinylcyclohexa-1,3-dien-1-ol (CID 122662756) is 5-hydrazinylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 5-hydrazinylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 5-hydrazinylcyclohexa-1,3-dien-1-ol is NNC1C=CC=C(O)C1.
What is the InChIKey of 5-hydrazinylcyclohexa-1,3-dien-1-ol?
The InChIKey is URIZNYYQEKUWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c7-8-5-2-1-3-6(9)4-5/h1-3,5,8-9H,4,7H2.
What are the key properties of 5-hydrazinylcyclohexa-1,3-dien-1-ol?
5-hydrazinylcyclohexa-1,3-dien-1-ol has a molecular weight of 126.16 g/mol, XLogP of 0.22, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydrazinylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 122662756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).