About N'-cyano-4,4-difluoropiperidine-1-carboximidamide
N'-cyano-4,4-difluoropiperidine-1-carboximidamide (PubChem CID 122662849) has the molecular formula C7H10F2N4
and a molecular weight of 188.18 g/mol. Its IUPAC name is N'-cyano-4,4-difluoropiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-cyano-4,4-difluoropiperidine-1-carboximidamide |
| PubChem CID | 122662849 |
| Molecular Formula | C7H10F2N4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | N'-cyano-4,4-difluoropiperidine-1-carboximidamide |
| SMILES | N#C/N=C(\N)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C7H10F2N4/c8-7(9)1-3-13(4-2-7)6(11)12-5-10/h1-4H2,(H2,11,12) |
| InChIKey | FNVLLLFDJKZLHZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-cyano-4,4-difluoropiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyano-4,4-difluoropiperidine-1-carboximidamide?
The IUPAC name of N'-cyano-4,4-difluoropiperidine-1-carboximidamide (CID 122662849) is N'-cyano-4,4-difluoropiperidine-1-carboximidamide.
What is the SMILES notation for N'-cyano-4,4-difluoropiperidine-1-carboximidamide?
The canonical SMILES for N'-cyano-4,4-difluoropiperidine-1-carboximidamide is N#C/N=C(\N)N1CCC(F)(F)CC1.
What is the InChIKey of N'-cyano-4,4-difluoropiperidine-1-carboximidamide?
The InChIKey is FNVLLLFDJKZLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2N4/c8-7(9)1-3-13(4-2-7)6(11)12-5-10/h1-4H2,(H2,11,12).
What are the key properties of N'-cyano-4,4-difluoropiperidine-1-carboximidamide?
N'-cyano-4,4-difluoropiperidine-1-carboximidamide has a molecular weight of 188.18 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyano-4,4-difluoropiperidine-1-carboximidamide is sourced from PubChem (CID 122662849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).