C15H21F2N5O3 — CID 122662858
3,3-difluoro-N'-[N'-(3,4,5-trimethoxyphenyl)carbamimidoyl]pyrrolidine-1-carboximidamide (PubChem CID 122662858) has the molecular formula C15H21F2N5O3 and a molecular weight of 357.36 g/mol. Its IUPAC name is 3,3-difluoro-N'-[N'-(3,4,5-trimethoxyphenyl)carbamimidoyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3,3-difluoro-N'-[N'-(3,4,5-trimethoxyphenyl)carbamimidoyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 122662858 |
| Molecular Formula | C15H21F2N5O3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3,3-difluoro-N'-[N'-(3,4,5-trimethoxyphenyl)carbamimidoyl]pyrrolidine-1-carboximidamide |
| SMILES | COc1cc(/N=C(N)/N=C(\N)N2CCC(F)(F)C2)cc(OC)c1OC |
| InChI | InChI=1S/C15H21F2N5O3/c1-23-10-6-9(7-11(24-2)12(10)25-3)20-13(18)21-14(19)22-5-4-15(16,17)8-22/h6-7H,4-5,8H2,1-3H3,(H4,18,19,20,21) |
| InChIKey | ABDRDPZNJDKADF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|