About 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide
4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide (PubChem CID 122662881) has the molecular formula C15H24N4O
and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide.
Molecular Properties
| Compound Name | 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide |
| PubChem CID | 122662881 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide |
| SMILES | CCNc1cc(N[C@@H]2CCCC[C@@H]2N)ccc1C(N)=O |
| InChI | InChI=1S/C15H24N4O/c1-2-18-14-9-10(7-8-11(14)15(17)20)19-13-6-4-3-5-12(13)16/h7-9,12-13,18-19H,2-6,16H2,1H3,(H2,17,20)/t12-,13+/m0/s1 |
| InChIKey | QNAUILGKJQMKHE-QWHCGFSZSA-N |
| XLogP | 1.90 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide?
The IUPAC name of 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide (CID 122662881) is 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide.
What is the SMILES notation for 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide?
The canonical SMILES for 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide is CCNc1cc(N[C@@H]2CCCC[C@@H]2N)ccc1C(N)=O.
What is the InChIKey of 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide?
The InChIKey is QNAUILGKJQMKHE-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H24N4O/c1-2-18-14-9-10(7-8-11(14)15(17)20)19-13-6-4-3-5-12(13)16/h7-9,12-13,18-19H,2-6,16H2,1H3,(H2,17,20)/t12-,13+/m0/s1.
What are the key properties of 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide?
4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide has a molecular weight of 276.38 g/mol, XLogP of 1.90, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-(ethylamino)benzamide is sourced from PubChem (CID 122662881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).