About (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol
(1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol (PubChem CID 122663518) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol.
Molecular Properties
| Compound Name | (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol |
| PubChem CID | 122663518 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol |
| SMILES | CCC/C=C(/C=C\S)C(C)N |
| InChI | InChI=1S/C9H17NS/c1-3-4-5-9(6-7-11)8(2)10/h5-8,11H,3-4,10H2,1-2H3/b7-6-,9-5- |
| InChIKey | WJLANXRWXGIAEP-LKDPLPNCSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol?
The IUPAC name of (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol (CID 122663518) is (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol.
What is the SMILES notation for (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol?
The canonical SMILES for (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol is CCC/C=C(/C=C\S)C(C)N.
What is the InChIKey of (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol?
The InChIKey is WJLANXRWXGIAEP-LKDPLPNCSA-N. The full InChI is InChI=1S/C9H17NS/c1-3-4-5-9(6-7-11)8(2)10/h5-8,11H,3-4,10H2,1-2H3/b7-6-,9-5-.
What are the key properties of (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol?
(1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol has a molecular weight of 171.31 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-3-(1-aminoethyl)hepta-1,3-diene-1-thiol is sourced from PubChem (CID 122663518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).