C18H23F5O6 — CID 122663899
2,2,4,4,4-pentafluorobutyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 122663899) has the molecular formula C18H23F5O6 and a molecular weight of 430.37 g/mol. Its IUPAC name is 2,2,4,4,4-pentafluorobutyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | 2,2,4,4,4-pentafluorobutyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 122663899 |
| Molecular Formula | C18H23F5O6 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2,2,4,4,4-pentafluorobutyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C(=O)OCC(F)(F)CC(F)(F)F)C2CC1OC2=O |
| InChI | InChI=1S/C18H23F5O6/c1-4-16(2,3)15(26)29-12-5-9(10-6-11(12)28-14(10)25)13(24)27-8-17(19,20)7-18(21,22)23/h9-12H,4-8H2,1-3H3 |
| InChIKey | DKAZLICTKZBDGE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|