C16H21F3O6 — CID 122663913
2,2,2-trifluoroethyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 122663913) has the molecular formula C16H21F3O6 and a molecular weight of 366.33 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 122663913 |
| Molecular Formula | C16H21F3O6 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-(2,2-dimethylbutanoyloxy)-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C(=O)OCC(F)(F)F)C2CC1OC2=O |
| InChI | InChI=1S/C16H21F3O6/c1-4-15(2,3)14(22)25-11-5-8(9-6-10(11)24-13(9)21)12(20)23-7-16(17,18)19/h8-11H,4-7H2,1-3H3 |
| InChIKey | MQHRCVPCJMGVLJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|