About 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran
4-(2-methylpropyl)-1,3-dihydro-2-benzofuran (PubChem CID 122663965) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran |
| PubChem CID | 122663965 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran |
| SMILES | CC(C)Cc1cccc2c1COC2 |
| InChI | InChI=1S/C12H16O/c1-9(2)6-10-4-3-5-11-7-13-8-12(10)11/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | XUSWXRTWUKNDAS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran?
The IUPAC name of 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran (CID 122663965) is 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran?
The canonical SMILES for 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran is CC(C)Cc1cccc2c1COC2.
What is the InChIKey of 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran?
The InChIKey is XUSWXRTWUKNDAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-9(2)6-10-4-3-5-11-7-13-8-12(10)11/h3-5,9H,6-8H2,1-2H3.
What are the key properties of 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran?
4-(2-methylpropyl)-1,3-dihydro-2-benzofuran has a molecular weight of 176.26 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 122663965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).