About 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione
3-amino-5-ethyl-1,3-oxazolidine-2,4-dione (PubChem CID 122664066) has the molecular formula C5H8N2O3
and a molecular weight of 144.13 g/mol. Its IUPAC name is 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione |
| PubChem CID | 122664066 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione |
| SMILES | CCC1OC(=O)N(N)C1=O |
| InChI | InChI=1S/C5H8N2O3/c1-2-3-4(8)7(6)5(9)10-3/h3H,2,6H2,1H3 |
| InChIKey | JTGDKPJJUXKAFU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione?
The IUPAC name of 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione (CID 122664066) is 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione is CCC1OC(=O)N(N)C1=O.
What is the InChIKey of 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione?
The InChIKey is JTGDKPJJUXKAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3/c1-2-3-4(8)7(6)5(9)10-3/h3H,2,6H2,1H3.
What are the key properties of 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione?
3-amino-5-ethyl-1,3-oxazolidine-2,4-dione has a molecular weight of 144.13 g/mol, XLogP of -0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-ethyl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 122664066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).