C31H46O7 — CID 122664091
[(1R,2S,3S)-4-(2-oxo-4-phenylbutyl)-2,3-di(pentanoyloxy)cyclohexyl] pentanoate (PubChem CID 122664091) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is [(1R,2S,3S)-4-(2-oxo-4-phenylbutyl)-2,3-di(pentanoyloxy)cyclohexyl] pentanoate.
| Compound Name | [(1R,2S,3S)-4-(2-oxo-4-phenylbutyl)-2,3-di(pentanoyloxy)cyclohexyl] pentanoate |
|---|---|
| PubChem CID | 122664091 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | [(1R,2S,3S)-4-(2-oxo-4-phenylbutyl)-2,3-di(pentanoyloxy)cyclohexyl] pentanoate |
| SMILES | CCCCC(=O)OC1CCC(CC(=O)CCc2ccccc2)[C@H](OC(=O)CCCC)[C@H]1OC(=O)CCCC |
| InChI | InChI=1S/C31H46O7/c1-4-7-15-27(33)36-26-21-19-24(22-25(32)20-18-23-13-11-10-12-14-23)30(37-28(34)16-8-5-2)31(26)38-29(35)17-9-6-3/h10-14,24,26,30-31H,4-9,15-22H2,1-3H3/t24?,26?,30-,31-/m0/s1 |
| InChIKey | YLDMEARFNAKRAH-LFKIPKKCSA-N |
| XLogP | 6.29 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|