About 4-tert-butyl-1,4-diethylpiperidine
4-tert-butyl-1,4-diethylpiperidine (PubChem CID 122664542) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 4-tert-butyl-1,4-diethylpiperidine.
Molecular Properties
| Compound Name | 4-tert-butyl-1,4-diethylpiperidine |
| PubChem CID | 122664542 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 4-tert-butyl-1,4-diethylpiperidine |
| SMILES | CCN1CCC(CC)(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27N/c1-6-13(12(3,4)5)8-10-14(7-2)11-9-13/h6-11H2,1-5H3 |
| InChIKey | PKXPIAQFTLBWJK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-1,4-diethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,4-diethylpiperidine?
The IUPAC name of 4-tert-butyl-1,4-diethylpiperidine (CID 122664542) is 4-tert-butyl-1,4-diethylpiperidine.
What is the SMILES notation for 4-tert-butyl-1,4-diethylpiperidine?
The canonical SMILES for 4-tert-butyl-1,4-diethylpiperidine is CCN1CCC(CC)(C(C)(C)C)CC1.
What is the InChIKey of 4-tert-butyl-1,4-diethylpiperidine?
The InChIKey is PKXPIAQFTLBWJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-6-13(12(3,4)5)8-10-14(7-2)11-9-13/h6-11H2,1-5H3.
What are the key properties of 4-tert-butyl-1,4-diethylpiperidine?
4-tert-butyl-1,4-diethylpiperidine has a molecular weight of 197.37 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,4-diethylpiperidine is sourced from PubChem (CID 122664542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).