C23H38N2 — CID 122664605
(6R)-3-(cyclohexen-1-yl)-6-[(Z,2S)-2-methanimidoyl-8-methylnon-4-enyl]cyclohex-3-en-1-amine (PubChem CID 122664605) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is (6R)-3-(cyclohexen-1-yl)-6-[(Z,2S)-2-methanimidoyl-8-methylnon-4-enyl]cyclohex-3-en-1-amine.
| Compound Name | (6R)-3-(cyclohexen-1-yl)-6-[(Z,2S)-2-methanimidoyl-8-methylnon-4-enyl]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 122664605 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | (6R)-3-(cyclohexen-1-yl)-6-[(Z,2S)-2-methanimidoyl-8-methylnon-4-enyl]cyclohex-3-en-1-amine |
| SMILES | [H]/N=C/[C@@H](C/C=C\CCC(C)C)C[C@H]1CC=C(C2=CCCCC2)CC1N |
| InChI | InChI=1S/C23H38N2/c1-18(2)9-5-3-6-10-19(17-24)15-22-14-13-21(16-23(22)25)20-11-7-4-8-12-20/h3,6,11,13,17-19,22-24H,4-5,7-10,12,14-16,25H2,1-2H3/b6-3-,24-17+/t19-,22+,23?/m0/s1 |
| InChIKey | VPZNJWZXNTZNKW-FEMYPMKNSA-N |
| XLogP | 6.19 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|