About 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine
6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine (PubChem CID 122664606) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine.
Analyze 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine?
The IUPAC name of 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine (CID 122664606) is 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine.
What is the SMILES notation for 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine?
The canonical SMILES for 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine is NC1CCCC(C2=CCCCC2)=N1.
What is the InChIKey of 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine?
The InChIKey is YDIJVBPDABRFIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c12-11-8-4-7-10(13-11)9-5-2-1-3-6-9/h5,11H,1-4,6-8,12H2.
What are the key properties of 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine?
6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine has a molecular weight of 178.28 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(cyclohexen-1-yl)-2,3,4,5-tetrahydropyridin-2-amine is sourced from PubChem (CID 122664606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).