C26H34N2O3 — CID 122664623
2-cyclopentyl-2-hydroxy-1-[4-[2-(4-methoxyphenyl)ethyl]piperazin-1-yl]-2-phenylethanone (PubChem CID 122664623) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-cyclopentyl-2-hydroxy-1-[4-[2-(4-methoxyphenyl)ethyl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 2-cyclopentyl-2-hydroxy-1-[4-[2-(4-methoxyphenyl)ethyl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 122664623 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-cyclopentyl-2-hydroxy-1-[4-[2-(4-methoxyphenyl)ethyl]piperazin-1-yl]-2-phenylethanone |
| SMILES | COc1ccc(CCN2CCN(C(=O)C(O)(c3ccccc3)C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-31-24-13-11-21(12-14-24)15-16-27-17-19-28(20-18-27)25(29)26(30,23-9-5-6-10-23)22-7-3-2-4-8-22/h2-4,7-8,11-14,23,30H,5-6,9-10,15-20H2,1H3 |
| InChIKey | NTNKTJZGUOLLSE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |