C36H22N6 — CID 122666027
6-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)phenyl]benzo[k]phenanthridine (PubChem CID 122666027) has the molecular formula C36H22N6 and a molecular weight of 538.61 g/mol. Its IUPAC name is 6-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)phenyl]benzo[k]phenanthridine.
| Compound Name | 6-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)phenyl]benzo[k]phenanthridine |
|---|---|
| PubChem CID | 122666027 |
| Molecular Formula | C36H22N6 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 6-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)phenyl]benzo[k]phenanthridine |
| SMILES | c1cncc(-c2nc(-c3ccc(-c4nc5ccccc5c5c4ccc4ccccc45)cc3)nc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C36H22N6/c1-2-10-28-23(7-1)17-18-30-32(28)29-11-3-4-12-31(29)39-33(30)24-13-15-25(16-14-24)34-40-35(26-8-5-19-37-21-26)42-36(41-34)27-9-6-20-38-22-27/h1-22H |
| InChIKey | ZNIIVNTWQCAQKP-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|