C17H15F3N2O — CID 122666042
2,2,2-trifluoro-1-(14-methylidene-8,11-diazatetracyclo[8.3.3.01,9.02,7]hexadeca-2,4,6,8-tetraen-11-yl)ethanone (PubChem CID 122666042) has the molecular formula C17H15F3N2O and a molecular weight of 320.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(14-methylidene-8,11-diazatetracyclo[8.3.3.01,9.02,7]hexadeca-2,4,6,8-tetraen-11-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(14-methylidene-8,11-diazatetracyclo[8.3.3.01,9.02,7]hexadeca-2,4,6,8-tetraen-11-yl)ethanone |
|---|---|
| PubChem CID | 122666042 |
| Molecular Formula | C17H15F3N2O |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2,2,2-trifluoro-1-(14-methylidene-8,11-diazatetracyclo[8.3.3.01,9.02,7]hexadeca-2,4,6,8-tetraen-11-yl)ethanone |
| SMILES | C=C1CCC2C3=Nc4ccccc4C13CCN2C(=O)C(F)(F)F |
| InChI | InChI=1S/C17H15F3N2O/c1-10-6-7-13-14-16(10,11-4-2-3-5-12(11)21-14)8-9-22(13)15(23)17(18,19)20/h2-5,13H,1,6-9H2 |
| InChIKey | IPVIDTNGPPTOGD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|