C22H18N2 — CID 122666287
4-[(9,9-dimethylfluoren-4-yl)amino]benzonitrile (PubChem CID 122666287) has the molecular formula C22H18N2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[(9,9-dimethylfluoren-4-yl)amino]benzonitrile.
| Compound Name | 4-[(9,9-dimethylfluoren-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 122666287 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[(9,9-dimethylfluoren-4-yl)amino]benzonitrile |
| SMILES | CC1(C)c2ccccc2-c2c(Nc3ccc(C#N)cc3)cccc21 |
| InChI | InChI=1S/C22H18N2/c1-22(2)18-7-4-3-6-17(18)21-19(22)8-5-9-20(21)24-16-12-10-15(14-23)11-13-16/h3-13,24H,1-2H3 |
| InChIKey | KJUVJIPOFFJCGZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |