C13H20N4O — CID 122666637
5-[[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]pyridin-2-amine (PubChem CID 122666637) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 5-[[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]pyridin-2-amine.
| Compound Name | 5-[[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 122666637 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 5-[[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]methyl]pyridin-2-amine |
| SMILES | Nc1ccc(CN2CCN3CCOC[C@H]3C2)cn1 |
| InChI | InChI=1S/C13H20N4O/c14-13-2-1-11(7-15-13)8-16-3-4-17-5-6-18-10-12(17)9-16/h1-2,7,12H,3-6,8-10H2,(H2,14,15)/t12-/m1/s1 |
| InChIKey | GRYUJKIBYLTJIF-GFCCVEGCSA-N |
| XLogP | 0.18 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |