About 6-ethynyl-2-methyl-2,3-dihydropyridine
6-ethynyl-2-methyl-2,3-dihydropyridine (PubChem CID 122666715) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 6-ethynyl-2-methyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-ethynyl-2-methyl-2,3-dihydropyridine |
| PubChem CID | 122666715 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 6-ethynyl-2-methyl-2,3-dihydropyridine |
| SMILES | C#CC1=NC(C)CC=C1 |
| InChI | InChI=1S/C8H9N/c1-3-8-6-4-5-7(2)9-8/h1,4,6-7H,5H2,2H3 |
| InChIKey | ZYDOXYRMXLBWDL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-ethynyl-2-methyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethynyl-2-methyl-2,3-dihydropyridine?
The IUPAC name of 6-ethynyl-2-methyl-2,3-dihydropyridine (CID 122666715) is 6-ethynyl-2-methyl-2,3-dihydropyridine.
What is the SMILES notation for 6-ethynyl-2-methyl-2,3-dihydropyridine?
The canonical SMILES for 6-ethynyl-2-methyl-2,3-dihydropyridine is C#CC1=NC(C)CC=C1.
What is the InChIKey of 6-ethynyl-2-methyl-2,3-dihydropyridine?
The InChIKey is ZYDOXYRMXLBWDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-3-8-6-4-5-7(2)9-8/h1,4,6-7H,5H2,2H3.
What are the key properties of 6-ethynyl-2-methyl-2,3-dihydropyridine?
6-ethynyl-2-methyl-2,3-dihydropyridine has a molecular weight of 119.17 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethynyl-2-methyl-2,3-dihydropyridine is sourced from PubChem (CID 122666715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).