About 2-iodosulfanylacetic acid
2-iodosulfanylacetic acid (PubChem CID 122666732) has the molecular formula C2H3IO2S
and a molecular weight of 218.01 g/mol. Its IUPAC name is 2-iodosulfanylacetic acid.
Molecular Properties
| Compound Name | 2-iodosulfanylacetic acid |
| PubChem CID | 122666732 |
| Molecular Formula | C2H3IO2S |
| Molecular Weight | 218.01 g/mol |
| Exact Mass | 217.89 |
| IUPAC Name | 2-iodosulfanylacetic acid |
| SMILES | O=C(O)CSI |
| InChI | InChI=1S/C2H3IO2S/c3-6-1-2(4)5/h1H2,(H,4,5) |
| InChIKey | LECFFXKSGYNPGR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.01 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodosulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodosulfanylacetic acid?
The IUPAC name of 2-iodosulfanylacetic acid (CID 122666732) is 2-iodosulfanylacetic acid.
What is the SMILES notation for 2-iodosulfanylacetic acid?
The canonical SMILES for 2-iodosulfanylacetic acid is O=C(O)CSI.
What is the InChIKey of 2-iodosulfanylacetic acid?
The InChIKey is LECFFXKSGYNPGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3IO2S/c3-6-1-2(4)5/h1H2,(H,4,5).
What are the key properties of 2-iodosulfanylacetic acid?
2-iodosulfanylacetic acid has a molecular weight of 218.01 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodosulfanylacetic acid is sourced from PubChem (CID 122666732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).