C53H100N2O — CID 122666811
(11Z,14Z)-N-decan-5-yl-N-[3-(dimethylamino)propyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienamide (PubChem CID 122666811) has the molecular formula C53H100N2O and a molecular weight of 781.40 g/mol. Its IUPAC name is (11Z,14Z)-N-decan-5-yl-N-[3-(dimethylamino)propyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienamide.
| Compound Name | (11Z,14Z)-N-decan-5-yl-N-[3-(dimethylamino)propyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienamide |
|---|---|
| PubChem CID | 122666811 |
| Molecular Formula | C53H100N2O |
| Molecular Weight | 781.40 g/mol |
| Exact Mass | 780.78 |
| IUPAC Name | (11Z,14Z)-N-decan-5-yl-N-[3-(dimethylamino)propyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)C(=O)N(CCCN(C)C)C(CCCC)CCCCC |
| InChI | InChI=1S/C53H100N2O/c1-7-11-15-17-19-21-23-25-27-29-31-33-35-37-39-42-45-51(46-43-40-38-36-34-32-30-28-26-24-22-20-18-16-12-8-2)53(56)55(50-44-49-54(5)6)52(47-14-10-4)48-41-13-9-3/h19-22,25-28,51-52H,7-18,23-24,29-50H2,1-6H3/b21-19-,22-20-,27-25-,28-26- |
| InChIKey | BSKXTWIJWJWCQB-BZMZSGPXSA-N |
| XLogP | 16.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.40 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|